C19H17NO4S — CID 52946972
methyl 3-[[2-(4-methylphenyl)sulfanylacetyl]amino]-1-benzofuran-2-carboxylate (PubChem CID 52946972) has the molecular formula C19H17NO4S and a molecular weight of 355.42 g/mol. Its IUPAC name is methyl 3-[[2-(4-methylphenyl)sulfanylacetyl]amino]-1-benzofuran-2-carboxylate.
| Compound Name | methyl 3-[[2-(4-methylphenyl)sulfanylacetyl]amino]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 52946972 |
| Molecular Formula | C19H17NO4S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | methyl 3-[[2-(4-methylphenyl)sulfanylacetyl]amino]-1-benzofuran-2-carboxylate |
| SMILES | COC(=O)c1oc2ccccc2c1NC(=O)CSc1ccc(C)cc1 |
| InChI | InChI=1S/C19H17NO4S/c1-12-7-9-13(10-8-12)25-11-16(21)20-17-14-5-3-4-6-15(14)24-18(17)19(22)23-2/h3-10H,11H2,1-2H3,(H,20,21) |
| InChIKey | ZMITXFKGOHLREG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |