C24H18BrNO4S — CID 25261663
methyl 3-[[2-(4-bromophenyl)sulfanyl-2-phenylacetyl]amino]-1-benzofuran-2-carboxylate (PubChem CID 25261663) has the molecular formula C24H18BrNO4S and a molecular weight of 496.38 g/mol. Its IUPAC name is methyl 3-[[2-(4-bromophenyl)sulfanyl-2-phenylacetyl]amino]-1-benzofuran-2-carboxylate.
| Compound Name | methyl 3-[[2-(4-bromophenyl)sulfanyl-2-phenylacetyl]amino]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 25261663 |
| Molecular Formula | C24H18BrNO4S |
| Molecular Weight | 496.38 g/mol |
| Exact Mass | 495.01 |
| IUPAC Name | methyl 3-[[2-(4-bromophenyl)sulfanyl-2-phenylacetyl]amino]-1-benzofuran-2-carboxylate |
| SMILES | COC(=O)c1oc2ccccc2c1NC(=O)C(Sc1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H18BrNO4S/c1-29-24(28)21-20(18-9-5-6-10-19(18)30-21)26-23(27)22(15-7-3-2-4-8-15)31-17-13-11-16(25)12-14-17/h2-14,22H,1H3,(H,26,27) |
| InChIKey | NNVNVYKAXWHBRA-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.38 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |