C28H23BrN2O2S — CID 21168358
N-(4-bromophenyl)-2-phenyl-2-[4-[(2-phenylacetyl)amino]phenyl]sulfanylacetamide (PubChem CID 21168358) has the molecular formula C28H23BrN2O2S and a molecular weight of 531.48 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-phenyl-2-[4-[(2-phenylacetyl)amino]phenyl]sulfanylacetamide.
| Compound Name | N-(4-bromophenyl)-2-phenyl-2-[4-[(2-phenylacetyl)amino]phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 21168358 |
| Molecular Formula | C28H23BrN2O2S |
| Molecular Weight | 531.48 g/mol |
| Exact Mass | 530.07 |
| IUPAC Name | N-(4-bromophenyl)-2-phenyl-2-[4-[(2-phenylacetyl)amino]phenyl]sulfanylacetamide |
| SMILES | O=C(Cc1ccccc1)Nc1ccc(SC(C(=O)Nc2ccc(Br)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H23BrN2O2S/c29-22-11-13-24(14-12-22)31-28(33)27(21-9-5-2-6-10-21)34-25-17-15-23(16-18-25)30-26(32)19-20-7-3-1-4-8-20/h1-18,27H,19H2,(H,30,32)(H,31,33) |
| InChIKey | CVYAHKCHMXMJHA-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.48 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |