C27H22ClN3O2S — CID 23098794
N-(5-chloro-2-pyridinyl)-2-phenyl-2-[4-[(2-phenylacetyl)amino]phenyl]sulfanylacetamide (PubChem CID 23098794) has the molecular formula C27H22ClN3O2S and a molecular weight of 488.01 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-phenyl-2-[4-[(2-phenylacetyl)amino]phenyl]sulfanylacetamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-phenyl-2-[4-[(2-phenylacetyl)amino]phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 23098794 |
| Molecular Formula | C27H22ClN3O2S |
| Molecular Weight | 488.01 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-phenyl-2-[4-[(2-phenylacetyl)amino]phenyl]sulfanylacetamide |
| SMILES | O=C(Cc1ccccc1)Nc1ccc(SC(C(=O)Nc2ccc(Cl)cn2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H22ClN3O2S/c28-21-11-16-24(29-18-21)31-27(33)26(20-9-5-2-6-10-20)34-23-14-12-22(13-15-23)30-25(32)17-19-7-3-1-4-8-19/h1-16,18,26H,17H2,(H,30,32)(H,29,31,33) |
| InChIKey | CDWIKRVQSZDTDP-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.01 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |