C26H21ClN4OS2 — CID 19712703
N-(5-chloro-2-pyridinyl)-2-phenyl-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylacetamide (PubChem CID 19712703) has the molecular formula C26H21ClN4OS2 and a molecular weight of 505.07 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-phenyl-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylacetamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-phenyl-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 19712703 |
| Molecular Formula | C26H21ClN4OS2 |
| Molecular Weight | 505.07 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-phenyl-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
| SMILES | O=C(Nc1ccc(Cl)cn1)C(Sc1ccc(NC(=S)Nc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H21ClN4OS2/c27-19-11-16-23(28-17-19)31-25(32)24(18-7-3-1-4-8-18)34-22-14-12-21(13-15-22)30-26(33)29-20-9-5-2-6-10-20/h1-17,24H,(H,28,31,32)(H2,29,30,33) |
| InChIKey | RIJZJPXBTWZMFF-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.07 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|