C41H31ClN4O3S — CID 19714981
N-[(Z)-3-[4-[2-[(5-chloro-2-pyridinyl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19714981) has the molecular formula C41H31ClN4O3S and a molecular weight of 695.24 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-[(5-chloro-2-pyridinyl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-[(5-chloro-2-pyridinyl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19714981 |
| Molecular Formula | C41H31ClN4O3S |
| Molecular Weight | 695.24 g/mol |
| Exact Mass | 694.18 |
| IUPAC Name | N-[(Z)-3-[4-[2-[(5-chloro-2-pyridinyl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SC(C(=O)Nc2ccc(Cl)cn2)c2ccccc2)cc1)/C(=C/c1ccc(-c2ccccc2)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C41H31ClN4O3S/c42-33-20-25-37(43-27-33)46-41(49)38(31-12-6-2-7-13-31)50-35-23-21-34(22-24-35)44-40(48)36(45-39(47)32-14-8-3-9-15-32)26-28-16-18-30(19-17-28)29-10-4-1-5-11-29/h1-27,38H,(H,44,48)(H,45,47)(H,43,46,49)/b36-26- |
| InChIKey | SSMXSJOISCDDTB-QYVLQNAGSA-N |
| XLogP | 9.28 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.24 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|