C27H21Cl2N3OS2 — CID 19712860
N-(2,5-dichlorophenyl)-2-phenyl-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylacetamide (PubChem CID 19712860) has the molecular formula C27H21Cl2N3OS2 and a molecular weight of 538.53 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-phenyl-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylacetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-phenyl-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 19712860 |
| Molecular Formula | C27H21Cl2N3OS2 |
| Molecular Weight | 538.53 g/mol |
| Exact Mass | 537.05 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-phenyl-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)C(Sc1ccc(NC(=S)Nc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H21Cl2N3OS2/c28-19-11-16-23(29)24(17-19)32-26(33)25(18-7-3-1-4-8-18)35-22-14-12-21(13-15-22)31-27(34)30-20-9-5-2-6-10-20/h1-17,25H,(H,32,33)(H2,30,31,34) |
| InChIKey | OEHGHOAKJDAHAN-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.53 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|