C16H15BrN2O2S — CID 2675016
(2R)-2-(4-bromophenyl)sulfanyl-N-(methylcarbamoyl)-2-phenylacetamide (PubChem CID 2675016) has the molecular formula C16H15BrN2O2S and a molecular weight of 379.28 g/mol. Its IUPAC name is (2R)-2-(4-bromophenyl)sulfanyl-N-(methylcarbamoyl)-2-phenylacetamide.
| Compound Name | (2R)-2-(4-bromophenyl)sulfanyl-N-(methylcarbamoyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 2675016 |
| Molecular Formula | C16H15BrN2O2S |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | (2R)-2-(4-bromophenyl)sulfanyl-N-(methylcarbamoyl)-2-phenylacetamide |
| SMILES | CNC(=O)NC(=O)[C@H](Sc1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C16H15BrN2O2S/c1-18-16(21)19-15(20)14(11-5-3-2-4-6-11)22-13-9-7-12(17)8-10-13/h2-10,14H,1H3,(H2,18,19,20,21)/t14-/m1/s1 |
| InChIKey | BYZZJXUBVVFPCT-CQSZACIVSA-N |
| XLogP | 3.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |