C19H20N2O4S — CID 7842838
[(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] (2S)-2-phenyl-2-phenylsulfanylacetate (PubChem CID 7842838) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] (2S)-2-phenyl-2-phenylsulfanylacetate.
| Compound Name | [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] (2S)-2-phenyl-2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 7842838 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] (2S)-2-phenyl-2-phenylsulfanylacetate |
| SMILES | CNC(=O)NC(=O)[C@@H](C)OC(=O)[C@@H](Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O4S/c1-13(17(22)21-19(24)20-2)25-18(23)16(14-9-5-3-6-10-14)26-15-11-7-4-8-12-15/h3-13,16H,1-2H3,(H2,20,21,22,24)/t13-,16+/m1/s1 |
| InChIKey | QIGIGVGQMIASRU-CJNGLKHVSA-N |
| XLogP | 2.91 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |