C28H22O3S — CID 2386634
[(1R)-2-oxo-1,2-diphenylethyl] (2R)-2-phenyl-2-phenylsulfanylacetate (PubChem CID 2386634) has the molecular formula C28H22O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is [(1R)-2-oxo-1,2-diphenylethyl] (2R)-2-phenyl-2-phenylsulfanylacetate.
| Compound Name | [(1R)-2-oxo-1,2-diphenylethyl] (2R)-2-phenyl-2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 2386634 |
| Molecular Formula | C28H22O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | [(1R)-2-oxo-1,2-diphenylethyl] (2R)-2-phenyl-2-phenylsulfanylacetate |
| SMILES | O=C(c1ccccc1)[C@H](OC(=O)[C@H](Sc1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H22O3S/c29-25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22)31-28(30)27(23-17-9-3-10-18-23)32-24-19-11-4-12-20-24/h1-20,26-27H/t26-,27-/m1/s1 |
| InChIKey | KKPCIKRRAOTZGB-KAYWLYCHSA-N |
| XLogP | 6.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |