C25H19NO5 — CID 8926233
[(1S)-2-oxo-1,2-diphenylethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 8926233) has the molecular formula C25H19NO5 and a molecular weight of 413.43 g/mol. Its IUPAC name is [(1S)-2-oxo-1,2-diphenylethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [(1S)-2-oxo-1,2-diphenylethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 8926233 |
| Molecular Formula | C25H19NO5 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | [(1S)-2-oxo-1,2-diphenylethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | C[C@H](C(=O)O[C@H](C(=O)c1ccccc1)c1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H19NO5/c1-16(26-23(28)19-14-8-9-15-20(19)24(26)29)25(30)31-22(18-12-6-3-7-13-18)21(27)17-10-4-2-5-11-17/h2-16,22H,1H3/t16-,22+/m1/s1 |
| InChIKey | TZROBYANRZTSCG-ZHRRBRCNSA-N |
| XLogP | 3.84 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|