C27H23NO5 — CID 2435251
[(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 2435251) has the molecular formula C27H23NO5 and a molecular weight of 441.48 g/mol. Its IUPAC name is [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 2435251 |
| Molecular Formula | C27H23NO5 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | Cc1ccc(C(=O)[C@H](OC(=O)[C@@H](C)N2C(=O)c3ccccc3C2=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H23NO5/c1-16-8-12-19(13-9-16)23(29)24(20-14-10-17(2)11-15-20)33-27(32)18(3)28-25(30)21-6-4-5-7-22(21)26(28)31/h4-15,18,24H,1-3H3/t18-,24-/m1/s1 |
| InChIKey | YPYRXXJRLBWSFQ-HOYKHHGWSA-N |
| XLogP | 4.46 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|