C29H24O3 — CID 2926355
[2-(4-methylphenyl)-2-oxo-1-phenylethyl] 2,2-diphenylacetate (PubChem CID 2926355) has the molecular formula C29H24O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is [2-(4-methylphenyl)-2-oxo-1-phenylethyl] 2,2-diphenylacetate.
| Compound Name | [2-(4-methylphenyl)-2-oxo-1-phenylethyl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 2926355 |
| Molecular Formula | C29H24O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [2-(4-methylphenyl)-2-oxo-1-phenylethyl] 2,2-diphenylacetate |
| SMILES | Cc1ccc(C(=O)C(OC(=O)C(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H24O3/c1-21-17-19-24(20-18-21)27(30)28(25-15-9-4-10-16-25)32-29(31)26(22-11-5-2-6-12-22)23-13-7-3-8-14-23/h2-20,26,28H,1H3 |
| InChIKey | FEDPZWQLFDIRHM-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |