C26H26O3 — CID 7811117
[(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] (2R)-2-phenylbutanoate (PubChem CID 7811117) has the molecular formula C26H26O3 and a molecular weight of 386.49 g/mol. Its IUPAC name is [(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] (2R)-2-phenylbutanoate.
| Compound Name | [(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] (2R)-2-phenylbutanoate |
|---|---|
| PubChem CID | 7811117 |
| Molecular Formula | C26H26O3 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | [(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] (2R)-2-phenylbutanoate |
| SMILES | CC[C@@H](C(=O)O[C@H](C(=O)c1ccc(C)cc1)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H26O3/c1-4-23(20-8-6-5-7-9-20)26(28)29-25(22-16-12-19(3)13-17-22)24(27)21-14-10-18(2)11-15-21/h5-17,23,25H,4H2,1-3H3/t23-,25+/m1/s1 |
| InChIKey | YYKRISYGFADFMA-NOZRDPDXSA-N |
| XLogP | 5.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |