C23H19FO3 — CID 7873233
[(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 2-fluorobenzoate (PubChem CID 7873233) has the molecular formula C23H19FO3 and a molecular weight of 362.40 g/mol. Its IUPAC name is [(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 2-fluorobenzoate.
| Compound Name | [(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 7873233 |
| Molecular Formula | C23H19FO3 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | [(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 2-fluorobenzoate |
| SMILES | Cc1ccc(C(=O)[C@@H](OC(=O)c2ccccc2F)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H19FO3/c1-15-7-11-17(12-8-15)21(25)22(18-13-9-16(2)10-14-18)27-23(26)19-5-3-4-6-20(19)24/h3-14,22H,1-2H3/t22-/m0/s1 |
| InChIKey | NWXRYQLUIJYWCK-QFIPXVFZSA-N |
| XLogP | 5.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |