C22H17ClO4 — CID 3276868
[1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 2-methoxybenzoate (PubChem CID 3276868) has the molecular formula C22H17ClO4 and a molecular weight of 380.83 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 2-methoxybenzoate.
| Compound Name | [1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 2-methoxybenzoate |
|---|---|
| PubChem CID | 3276868 |
| Molecular Formula | C22H17ClO4 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | [1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)OC(C(=O)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H17ClO4/c1-26-19-10-6-5-9-18(19)22(25)27-21(16-11-13-17(23)14-12-16)20(24)15-7-3-2-4-8-15/h2-14,21H,1H3 |
| InChIKey | YVLNVUPAQYXWPC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |