C29H23ClO5 — CID 126188436
[(1R)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 4-[(2-methoxyphenoxy)methyl]benzoate (PubChem CID 126188436) has the molecular formula C29H23ClO5 and a molecular weight of 486.95 g/mol. Its IUPAC name is [(1R)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 4-[(2-methoxyphenoxy)methyl]benzoate.
| Compound Name | [(1R)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 4-[(2-methoxyphenoxy)methyl]benzoate |
|---|---|
| PubChem CID | 126188436 |
| Molecular Formula | C29H23ClO5 |
| Molecular Weight | 486.95 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | [(1R)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 4-[(2-methoxyphenoxy)methyl]benzoate |
| SMILES | COc1ccccc1OCc1ccc(C(=O)O[C@@H](C(=O)c2ccccc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C29H23ClO5/c1-33-25-9-5-6-10-26(25)34-19-20-11-13-23(14-12-20)29(32)35-28(22-15-17-24(30)18-16-22)27(31)21-7-3-2-4-8-21/h2-18,28H,19H2,1H3/t28-/m1/s1 |
| InChIKey | ITQLXMMIRSIBRN-MUUNZHRXSA-N |
| XLogP | 6.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.95 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |