C29H23ClO4 — CID 126185839
[(1R)-2-(4-chlorophenyl)-2-oxo-1-phenylethyl] 4-[(3-methylphenoxy)methyl]benzoate (PubChem CID 126185839) has the molecular formula C29H23ClO4 and a molecular weight of 470.95 g/mol. Its IUPAC name is [(1R)-2-(4-chlorophenyl)-2-oxo-1-phenylethyl] 4-[(3-methylphenoxy)methyl]benzoate.
| Compound Name | [(1R)-2-(4-chlorophenyl)-2-oxo-1-phenylethyl] 4-[(3-methylphenoxy)methyl]benzoate |
|---|---|
| PubChem CID | 126185839 |
| Molecular Formula | C29H23ClO4 |
| Molecular Weight | 470.95 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | [(1R)-2-(4-chlorophenyl)-2-oxo-1-phenylethyl] 4-[(3-methylphenoxy)methyl]benzoate |
| SMILES | Cc1cccc(OCc2ccc(C(=O)O[C@@H](C(=O)c3ccc(Cl)cc3)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C29H23ClO4/c1-20-6-5-9-26(18-20)33-19-21-10-12-24(13-11-21)29(32)34-28(23-7-3-2-4-8-23)27(31)22-14-16-25(30)17-15-22/h2-18,28H,19H2,1H3/t28-/m1/s1 |
| InChIKey | SIDNXLYGRJAXBU-MUUNZHRXSA-N |
| XLogP | 7.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.95 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |