C29H22ClNO4 — CID 126187705
[(1R)-2-(4-chlorophenyl)-2-oxo-1-phenylethyl] 4-[(4-methylbenzoyl)amino]benzoate (PubChem CID 126187705) has the molecular formula C29H22ClNO4 and a molecular weight of 483.95 g/mol. Its IUPAC name is [(1R)-2-(4-chlorophenyl)-2-oxo-1-phenylethyl] 4-[(4-methylbenzoyl)amino]benzoate.
| Compound Name | [(1R)-2-(4-chlorophenyl)-2-oxo-1-phenylethyl] 4-[(4-methylbenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 126187705 |
| Molecular Formula | C29H22ClNO4 |
| Molecular Weight | 483.95 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | [(1R)-2-(4-chlorophenyl)-2-oxo-1-phenylethyl] 4-[(4-methylbenzoyl)amino]benzoate |
| SMILES | Cc1ccc(C(=O)Nc2ccc(C(=O)O[C@@H](C(=O)c3ccc(Cl)cc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C29H22ClNO4/c1-19-7-9-22(10-8-19)28(33)31-25-17-13-23(14-18-25)29(34)35-27(21-5-3-2-4-6-21)26(32)20-11-15-24(30)16-12-20/h2-18,27H,1H3,(H,31,33)/t27-/m1/s1 |
| InChIKey | AEJLSHGZKVQGOA-HHHXNRCGSA-N |
| XLogP | 6.68 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.95 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |