C21H13Cl3O3 — CID 11362139
[1,2-bis(4-chlorophenyl)-2-oxoethyl] 4-chlorobenzoate (PubChem CID 11362139) has the molecular formula C21H13Cl3O3 and a molecular weight of 419.69 g/mol. Its IUPAC name is [1,2-bis(4-chlorophenyl)-2-oxoethyl] 4-chlorobenzoate.
| Compound Name | [1,2-bis(4-chlorophenyl)-2-oxoethyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 11362139 |
| Molecular Formula | C21H13Cl3O3 |
| Molecular Weight | 419.69 g/mol |
| Exact Mass | 417.99 |
| IUPAC Name | [1,2-bis(4-chlorophenyl)-2-oxoethyl] 4-chlorobenzoate |
| SMILES | O=C(OC(C(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H13Cl3O3/c22-16-7-1-13(2-8-16)19(25)20(14-3-9-17(23)10-4-14)27-21(26)15-5-11-18(24)12-6-15/h1-12,20H |
| InChIKey | AWMLHVQGKNIKGX-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.69 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |