[1,2-bis(4-chlorophenyl)-2-oxoethyl] 4-chlorobenzoate

C21H13Cl3O3 — CID 11362139

IUPAC[1,2-bis(4-chlorophenyl)-2-oxoethyl] 4-chlorobenzoate
SMILESO=C(OC(C(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1)c1ccc(Cl)cc1
InChIInChI=1S/C21H13Cl3O3/c22-16-7-1-13(2-8-16)19(25)20(14-3-9-17(23)10-4-14)27-21(26)15-5-11-18(24)12-6-15/h1-12,20H
InChIKeyAWMLHVQGKNIKGX-UHFFFAOYSA-N
MW419.69 g/mol
LogP6.43
Rot. Bonds5

About [1,2-bis(4-chlorophenyl)-2-oxoethyl] 4-chlorobenzoate

[1,2-bis(4-chlorophenyl)-2-oxoethyl] 4-chlorobenzoate (PubChem CID 11362139) has the molecular formula C21H13Cl3O3 and a molecular weight of 419.69 g/mol. Its IUPAC name is [1,2-bis(4-chlorophenyl)-2-oxoethyl] 4-chlorobenzoate.

Molecular Properties

Compound Name[1,2-bis(4-chlorophenyl)-2-oxoethyl] 4-chlorobenzoate
PubChem CID11362139
Molecular FormulaC21H13Cl3O3
Molecular Weight419.69 g/mol
Exact Mass417.99
IUPAC Name[1,2-bis(4-chlorophenyl)-2-oxoethyl] 4-chlorobenzoate
SMILESO=C(OC(C(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1)c1ccc(Cl)cc1
InChIInChI=1S/C21H13Cl3O3/c22-16-7-1-13(2-8-16)19(25)20(14-3-9-17(23)10-4-14)27-21(26)15-5-11-18(24)12-6-15/h1-12,20H
InChIKeyAWMLHVQGKNIKGX-UHFFFAOYSA-N
XLogP6.43
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500419.69
LogP ≤ 56.43
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze [1,2-bis(4-chlorophenyl)-2-oxoethyl] 4-chlorobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [1,2-bis(4-chlorophenyl)-2-oxoethyl] 4-chlorobenzoate?
The IUPAC name of [1,2-bis(4-chlorophenyl)-2-oxoethyl] 4-chlorobenzoate (CID 11362139) is [1,2-bis(4-chlorophenyl)-2-oxoethyl] 4-chlorobenzoate.
What is the SMILES notation for [1,2-bis(4-chlorophenyl)-2-oxoethyl] 4-chlorobenzoate?
The canonical SMILES for [1,2-bis(4-chlorophenyl)-2-oxoethyl] 4-chlorobenzoate is O=C(OC(C(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1)c1ccc(Cl)cc1.
What is the InChIKey of [1,2-bis(4-chlorophenyl)-2-oxoethyl] 4-chlorobenzoate?
The InChIKey is AWMLHVQGKNIKGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13Cl3O3/c22-16-7-1-13(2-8-16)19(25)20(14-3-9-17(23)10-4-14)27-21(26)15-5-11-18(24)12-6-15/h1-12,20H.
What are the key properties of [1,2-bis(4-chlorophenyl)-2-oxoethyl] 4-chlorobenzoate?
[1,2-bis(4-chlorophenyl)-2-oxoethyl] 4-chlorobenzoate has a molecular weight of 419.69 g/mol, XLogP of 6.43, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2-bis(4-chlorophenyl)-2-oxoethyl] 4-chlorobenzoate is sourced from PubChem (CID 11362139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).