C19H18Cl2O3 — CID 44551031
[1,2-bis(4-chlorophenyl)-2-oxoethyl] 2,2-dimethylpropanoate (PubChem CID 44551031) has the molecular formula C19H18Cl2O3 and a molecular weight of 365.26 g/mol. Its IUPAC name is [1,2-bis(4-chlorophenyl)-2-oxoethyl] 2,2-dimethylpropanoate.
| Compound Name | [1,2-bis(4-chlorophenyl)-2-oxoethyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 44551031 |
| Molecular Formula | C19H18Cl2O3 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | [1,2-bis(4-chlorophenyl)-2-oxoethyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC(C(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18Cl2O3/c1-19(2,3)18(23)24-17(13-6-10-15(21)11-7-13)16(22)12-4-8-14(20)9-5-12/h4-11,17H,1-3H3 |
| InChIKey | ISAFRQVBGMGDMU-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |