C24H26Cl2O4 — CID 122517180
[(E)-1,2-bis(4-chlorophenyl)-2-(2,2-dimethylpropanoyloxy)ethenyl] 2,2-dimethylpropanoate (PubChem CID 122517180) has the molecular formula C24H26Cl2O4 and a molecular weight of 449.37 g/mol. Its IUPAC name is [(E)-1,2-bis(4-chlorophenyl)-2-(2,2-dimethylpropanoyloxy)ethenyl] 2,2-dimethylpropanoate.
| Compound Name | [(E)-1,2-bis(4-chlorophenyl)-2-(2,2-dimethylpropanoyloxy)ethenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 122517180 |
| Molecular Formula | C24H26Cl2O4 |
| Molecular Weight | 449.37 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | [(E)-1,2-bis(4-chlorophenyl)-2-(2,2-dimethylpropanoyloxy)ethenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O/C(=C(/OC(=O)C(C)(C)C)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H26Cl2O4/c1-23(2,3)21(27)29-19(15-7-11-17(25)12-8-15)20(30-22(28)24(4,5)6)16-9-13-18(26)14-10-16/h7-14H,1-6H3/b20-19+ |
| InChIKey | KKBJCSWRHSTGSK-FMQUCBEESA-N |
| XLogP | 7.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.37 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|