C16H20ClNO2 — CID 177489768
[(3E)-2-(4-chloroanilino)penta-1,3-dien-3-yl] 2,2-dimethylpropanoate (PubChem CID 177489768) has the molecular formula C16H20ClNO2 and a molecular weight of 293.79 g/mol. Its IUPAC name is [(3E)-2-(4-chloroanilino)penta-1,3-dien-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3E)-2-(4-chloroanilino)penta-1,3-dien-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 177489768 |
| Molecular Formula | C16H20ClNO2 |
| Molecular Weight | 293.79 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | [(3E)-2-(4-chloroanilino)penta-1,3-dien-3-yl] 2,2-dimethylpropanoate |
| SMILES | C=C(Nc1ccc(Cl)cc1)/C(=C\C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H20ClNO2/c1-6-14(20-15(19)16(3,4)5)11(2)18-13-9-7-12(17)8-10-13/h6-10,18H,2H2,1,3-5H3/b14-6+ |
| InChIKey | SQJXNUJAQMYZIJ-MKMNVTDBSA-N |
| XLogP | 4.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.79 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|