C12H11ClF3NO2 — CID 15111758
(Z)-4-(4-chloroanilino)-4-ethoxy-1,1,1-trifluorobut-3-en-2-one (PubChem CID 15111758) has the molecular formula C12H11ClF3NO2 and a molecular weight of 293.67 g/mol. Its IUPAC name is (Z)-4-(4-chloroanilino)-4-ethoxy-1,1,1-trifluorobut-3-en-2-one.
| Compound Name | (Z)-4-(4-chloroanilino)-4-ethoxy-1,1,1-trifluorobut-3-en-2-one |
|---|---|
| PubChem CID | 15111758 |
| Molecular Formula | C12H11ClF3NO2 |
| Molecular Weight | 293.67 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | (Z)-4-(4-chloroanilino)-4-ethoxy-1,1,1-trifluorobut-3-en-2-one |
| SMILES | CCO/C(=C\C(=O)C(F)(F)F)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H11ClF3NO2/c1-2-19-11(7-10(18)12(14,15)16)17-9-5-3-8(13)4-6-9/h3-7,17H,2H2,1H3/b11-7- |
| InChIKey | ZRFXDFVWZHZMQR-XFFZJAGNSA-N |
| XLogP | 3.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.67 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|