C14H16ClF3N2O4 — CID 3811515
ethyl 2-[(4-chlorophenyl)carbamoylamino]-2-ethoxy-3,3,3-trifluoropropanoate (PubChem CID 3811515) has the molecular formula C14H16ClF3N2O4 and a molecular weight of 368.74 g/mol. Its IUPAC name is ethyl 2-[(4-chlorophenyl)carbamoylamino]-2-ethoxy-3,3,3-trifluoropropanoate.
| Compound Name | ethyl 2-[(4-chlorophenyl)carbamoylamino]-2-ethoxy-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 3811515 |
| Molecular Formula | C14H16ClF3N2O4 |
| Molecular Weight | 368.74 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | ethyl 2-[(4-chlorophenyl)carbamoylamino]-2-ethoxy-3,3,3-trifluoropropanoate |
| SMILES | CCOC(=O)C(NC(=O)Nc1ccc(Cl)cc1)(OCC)C(F)(F)F |
| InChI | InChI=1S/C14H16ClF3N2O4/c1-3-23-11(21)13(24-4-2,14(16,17)18)20-12(22)19-10-7-5-9(15)6-8-10/h5-8H,3-4H2,1-2H3,(H2,19,20,22) |
| InChIKey | ZLWGNGPXAVYZCG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.74 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|