C15H18F3NO4 — CID 42583067
ethyl (2S)-2-benzamido-3,3,3-trifluoro-2-propoxypropanoate (PubChem CID 42583067) has the molecular formula C15H18F3NO4 and a molecular weight of 333.31 g/mol. Its IUPAC name is ethyl (2S)-2-benzamido-3,3,3-trifluoro-2-propoxypropanoate.
| Compound Name | ethyl (2S)-2-benzamido-3,3,3-trifluoro-2-propoxypropanoate |
|---|---|
| PubChem CID | 42583067 |
| Molecular Formula | C15H18F3NO4 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | ethyl (2S)-2-benzamido-3,3,3-trifluoro-2-propoxypropanoate |
| SMILES | CCCO[C@@](NC(=O)c1ccccc1)(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C15H18F3NO4/c1-3-10-23-14(15(16,17)18,13(21)22-4-2)19-12(20)11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | PIEPGKAKPDFWGY-AWEZNQCLSA-N |
| XLogP | 2.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|