C15H18F3N3O5 — CID 4219367
ethyl 2-[[amino(phenyl)methylidene]amino]oxy-2-(ethoxycarbonylamino)-3,3,3-trifluoropropanoate (PubChem CID 4219367) has the molecular formula C15H18F3N3O5 and a molecular weight of 377.32 g/mol. Its IUPAC name is ethyl 2-[[amino(phenyl)methylidene]amino]oxy-2-(ethoxycarbonylamino)-3,3,3-trifluoropropanoate.
| Compound Name | ethyl 2-[[amino(phenyl)methylidene]amino]oxy-2-(ethoxycarbonylamino)-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 4219367 |
| Molecular Formula | C15H18F3N3O5 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | ethyl 2-[[amino(phenyl)methylidene]amino]oxy-2-(ethoxycarbonylamino)-3,3,3-trifluoropropanoate |
| SMILES | CCOC(=O)NC(ON=C(N)c1ccccc1)(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C15H18F3N3O5/c1-3-24-12(22)14(15(16,17)18,20-13(23)25-4-2)26-21-11(19)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3,(H2,19,21)(H,20,23) |
| InChIKey | NGFQHOYWCRUQNM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|