C15H16F6N2O4 — CID 630134
ethyl 2-(ethoxycarbonylamino)-3,3,3-trifluoro-2-[2-(trifluoromethyl)anilino]propanoate (PubChem CID 630134) has the molecular formula C15H16F6N2O4 and a molecular weight of 402.29 g/mol. Its IUPAC name is ethyl 2-(ethoxycarbonylamino)-3,3,3-trifluoro-2-[2-(trifluoromethyl)anilino]propanoate.
| Compound Name | ethyl 2-(ethoxycarbonylamino)-3,3,3-trifluoro-2-[2-(trifluoromethyl)anilino]propanoate |
|---|---|
| PubChem CID | 630134 |
| Molecular Formula | C15H16F6N2O4 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | ethyl 2-(ethoxycarbonylamino)-3,3,3-trifluoro-2-[2-(trifluoromethyl)anilino]propanoate |
| SMILES | CCOC(=O)NC(Nc1ccccc1C(F)(F)F)(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C15H16F6N2O4/c1-3-26-11(24)13(15(19,20)21,23-12(25)27-4-2)22-10-8-6-5-7-9(10)14(16,17)18/h5-8,22H,3-4H2,1-2H3,(H,23,25) |
| InChIKey | HJIQCUIRMMATET-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|