C14H17F3N2O4 — CID 7037440
ethyl (2R)-2-acetamido-3,3,3-trifluoro-2-(2-methoxyanilino)propanoate (PubChem CID 7037440) has the molecular formula C14H17F3N2O4 and a molecular weight of 334.29 g/mol. Its IUPAC name is ethyl (2R)-2-acetamido-3,3,3-trifluoro-2-(2-methoxyanilino)propanoate.
| Compound Name | ethyl (2R)-2-acetamido-3,3,3-trifluoro-2-(2-methoxyanilino)propanoate |
|---|---|
| PubChem CID | 7037440 |
| Molecular Formula | C14H17F3N2O4 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | ethyl (2R)-2-acetamido-3,3,3-trifluoro-2-(2-methoxyanilino)propanoate |
| SMILES | CCOC(=O)[C@](NC(C)=O)(Nc1ccccc1OC)C(F)(F)F |
| InChI | InChI=1S/C14H17F3N2O4/c1-4-23-12(21)13(14(15,16)17,18-9(2)20)19-10-7-5-6-8-11(10)22-3/h5-8,19H,4H2,1-3H3,(H,18,20)/t13-/m0/s1 |
| InChIKey | CJIPONMRAOPELH-ZDUSSCGKSA-N |
| XLogP | 2.06 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|