C16H18F6N2O4 — CID 42587164
ethyl (2R)-3,3,3-trifluoro-2-[2-methoxy-5-(trifluoromethyl)anilino]-2-(propanoylamino)propanoate (PubChem CID 42587164) has the molecular formula C16H18F6N2O4 and a molecular weight of 416.32 g/mol. Its IUPAC name is ethyl (2R)-3,3,3-trifluoro-2-[2-methoxy-5-(trifluoromethyl)anilino]-2-(propanoylamino)propanoate.
| Compound Name | ethyl (2R)-3,3,3-trifluoro-2-[2-methoxy-5-(trifluoromethyl)anilino]-2-(propanoylamino)propanoate |
|---|---|
| PubChem CID | 42587164 |
| Molecular Formula | C16H18F6N2O4 |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | ethyl (2R)-3,3,3-trifluoro-2-[2-methoxy-5-(trifluoromethyl)anilino]-2-(propanoylamino)propanoate |
| SMILES | CCOC(=O)[C@](NC(=O)CC)(Nc1cc(C(F)(F)F)ccc1OC)C(F)(F)F |
| InChI | InChI=1S/C16H18F6N2O4/c1-4-12(25)24-14(16(20,21)22,13(26)28-5-2)23-10-8-9(15(17,18)19)6-7-11(10)27-3/h6-8,23H,4-5H2,1-3H3,(H,24,25)/t14-/m1/s1 |
| InChIKey | YAMBZRYJSFHIAQ-CQSZACIVSA-N |
| XLogP | 3.47 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|