C18H25F3N2O4 — CID 7360801
ethyl (2S)-2-(4-butoxyanilino)-3,3,3-trifluoro-2-(propanoylamino)propanoate (PubChem CID 7360801) has the molecular formula C18H25F3N2O4 and a molecular weight of 390.40 g/mol. Its IUPAC name is ethyl (2S)-2-(4-butoxyanilino)-3,3,3-trifluoro-2-(propanoylamino)propanoate.
| Compound Name | ethyl (2S)-2-(4-butoxyanilino)-3,3,3-trifluoro-2-(propanoylamino)propanoate |
|---|---|
| PubChem CID | 7360801 |
| Molecular Formula | C18H25F3N2O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | ethyl (2S)-2-(4-butoxyanilino)-3,3,3-trifluoro-2-(propanoylamino)propanoate |
| SMILES | CCCCOc1ccc(N[C@](NC(=O)CC)(C(=O)OCC)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H25F3N2O4/c1-4-7-12-27-14-10-8-13(9-11-14)22-17(18(19,20)21,16(25)26-6-3)23-15(24)5-2/h8-11,22H,4-7,12H2,1-3H3,(H,23,24)/t17-/m0/s1 |
| InChIKey | PTLFTAYHPGUVHC-KRWDZBQOSA-N |
| XLogP | 3.63 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|