C19H20F3N3O5S — CID 46499839
ethyl 3,3,3-trifluoro-2-[(2-phenylacetyl)amino]-2-(4-sulfamoylanilino)propanoate (PubChem CID 46499839) has the molecular formula C19H20F3N3O5S and a molecular weight of 459.45 g/mol. Its IUPAC name is ethyl 3,3,3-trifluoro-2-[(2-phenylacetyl)amino]-2-(4-sulfamoylanilino)propanoate.
| Compound Name | ethyl 3,3,3-trifluoro-2-[(2-phenylacetyl)amino]-2-(4-sulfamoylanilino)propanoate |
|---|---|
| PubChem CID | 46499839 |
| Molecular Formula | C19H20F3N3O5S |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | ethyl 3,3,3-trifluoro-2-[(2-phenylacetyl)amino]-2-(4-sulfamoylanilino)propanoate |
| SMILES | CCOC(=O)C(NC(=O)Cc1ccccc1)(Nc1ccc(S(N)(=O)=O)cc1)C(F)(F)F |
| InChI | InChI=1S/C19H20F3N3O5S/c1-2-30-17(27)18(19(20,21)22,25-16(26)12-13-6-4-3-5-7-13)24-14-8-10-15(11-9-14)31(23,28)29/h3-11,24H,2,12H2,1H3,(H,25,26)(H2,23,28,29) |
| InChIKey | RMISTXHFFALBCR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|