C18H17F3N2O5S — CID 3464263
methyl 2-(benzenesulfonamido)-3,3,3-trifluoro-2-[(2-phenylacetyl)amino]propanoate (PubChem CID 3464263) has the molecular formula C18H17F3N2O5S and a molecular weight of 430.40 g/mol. Its IUPAC name is methyl 2-(benzenesulfonamido)-3,3,3-trifluoro-2-[(2-phenylacetyl)amino]propanoate.
| Compound Name | methyl 2-(benzenesulfonamido)-3,3,3-trifluoro-2-[(2-phenylacetyl)amino]propanoate |
|---|---|
| PubChem CID | 3464263 |
| Molecular Formula | C18H17F3N2O5S |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | methyl 2-(benzenesulfonamido)-3,3,3-trifluoro-2-[(2-phenylacetyl)amino]propanoate |
| SMILES | COC(=O)C(NC(=O)Cc1ccccc1)(NS(=O)(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H17F3N2O5S/c1-28-16(25)17(18(19,20)21,22-15(24)12-13-8-4-2-5-9-13)23-29(26,27)14-10-6-3-7-11-14/h2-11,23H,12H2,1H3,(H,22,24) |
| InChIKey | MAZHBSSHTLHGBP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|