C15H16F3N3O5S — CID 3670709
ethyl 2-(benzenesulfonamido)-3,3,3-trifluoro-2-[(5-methyl-1,2-oxazol-3-yl)amino]propanoate (PubChem CID 3670709) has the molecular formula C15H16F3N3O5S and a molecular weight of 407.37 g/mol. Its IUPAC name is ethyl 2-(benzenesulfonamido)-3,3,3-trifluoro-2-[(5-methyl-1,2-oxazol-3-yl)amino]propanoate.
| Compound Name | ethyl 2-(benzenesulfonamido)-3,3,3-trifluoro-2-[(5-methyl-1,2-oxazol-3-yl)amino]propanoate |
|---|---|
| PubChem CID | 3670709 |
| Molecular Formula | C15H16F3N3O5S |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | ethyl 2-(benzenesulfonamido)-3,3,3-trifluoro-2-[(5-methyl-1,2-oxazol-3-yl)amino]propanoate |
| SMILES | CCOC(=O)C(Nc1cc(C)on1)(NS(=O)(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H16F3N3O5S/c1-3-25-13(22)14(15(16,17)18,19-12-9-10(2)26-20-12)21-27(23,24)11-7-5-4-6-8-11/h4-9,21H,3H2,1-2H3,(H,19,20) |
| InChIKey | QXMDJUHRIDOFTD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|