C17H16F4N2O4S — CID 4151094
ethyl 2-(benzenesulfonamido)-3,3,3-trifluoro-2-(3-fluoroanilino)propanoate (PubChem CID 4151094) has the molecular formula C17H16F4N2O4S and a molecular weight of 420.38 g/mol. Its IUPAC name is ethyl 2-(benzenesulfonamido)-3,3,3-trifluoro-2-(3-fluoroanilino)propanoate.
| Compound Name | ethyl 2-(benzenesulfonamido)-3,3,3-trifluoro-2-(3-fluoroanilino)propanoate |
|---|---|
| PubChem CID | 4151094 |
| Molecular Formula | C17H16F4N2O4S |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | ethyl 2-(benzenesulfonamido)-3,3,3-trifluoro-2-(3-fluoroanilino)propanoate |
| SMILES | CCOC(=O)C(Nc1cccc(F)c1)(NS(=O)(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H16F4N2O4S/c1-2-27-15(24)16(17(19,20)21,22-13-8-6-7-12(18)11-13)23-28(25,26)14-9-4-3-5-10-14/h3-11,22-23H,2H2,1H3 |
| InChIKey | FMEDNYHANIYCGE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|