C11H16N2O4S — CID 57069494
ethyl 2-amino-2-(benzenesulfonamido)propanoate (PubChem CID 57069494) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is ethyl 2-amino-2-(benzenesulfonamido)propanoate.
| Compound Name | ethyl 2-amino-2-(benzenesulfonamido)propanoate |
|---|---|
| PubChem CID | 57069494 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | ethyl 2-amino-2-(benzenesulfonamido)propanoate |
| SMILES | CCOC(=O)C(C)(N)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H16N2O4S/c1-3-17-10(14)11(2,12)13-18(15,16)9-7-5-4-6-8-9/h4-8,13H,3,12H2,1-2H3 |
| InChIKey | YIXWUEJQDCFAMO-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|