C10H15N3O3S — CID 67519869
2-amino-N'-(benzenesulfonyl)-2-methylpropanehydrazide (PubChem CID 67519869) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-amino-N'-(benzenesulfonyl)-2-methylpropanehydrazide.
| Compound Name | 2-amino-N'-(benzenesulfonyl)-2-methylpropanehydrazide |
|---|---|
| PubChem CID | 67519869 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 2-amino-N'-(benzenesulfonyl)-2-methylpropanehydrazide |
| SMILES | CC(C)(N)C(=O)NNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C10H15N3O3S/c1-10(2,11)9(14)12-13-17(15,16)8-6-4-3-5-7-8/h3-7,13H,11H2,1-2H3,(H,12,14) |
| InChIKey | RTGDNGUIJRIIOG-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|