C12H13F6N3O2S — CID 147257459
N'-[1-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)amino]ethenyl]benzenesulfonohydrazide (PubChem CID 147257459) has the molecular formula C12H13F6N3O2S and a molecular weight of 377.31 g/mol. Its IUPAC name is N'-[1-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)amino]ethenyl]benzenesulfonohydrazide.
| Compound Name | N'-[1-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)amino]ethenyl]benzenesulfonohydrazide |
|---|---|
| PubChem CID | 147257459 |
| Molecular Formula | C12H13F6N3O2S |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | N'-[1-[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)amino]ethenyl]benzenesulfonohydrazide |
| SMILES | C=C(NNS(=O)(=O)c1ccccc1)NC(C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H13F6N3O2S/c1-8(19-10(2,11(13,14)15)12(16,17)18)20-21-24(22,23)9-6-4-3-5-7-9/h3-7,19-21H,1H2,2H3 |
| InChIKey | CNXCCONUEFDYSB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|