C11H15N3O2S2 — CID 5223896
1-(benzenesulfonamido)-3-(2-methylprop-2-enyl)thiourea (PubChem CID 5223896) has the molecular formula C11H15N3O2S2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-(benzenesulfonamido)-3-(2-methylprop-2-enyl)thiourea.
| Compound Name | 1-(benzenesulfonamido)-3-(2-methylprop-2-enyl)thiourea |
|---|---|
| PubChem CID | 5223896 |
| Molecular Formula | C11H15N3O2S2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 1-(benzenesulfonamido)-3-(2-methylprop-2-enyl)thiourea |
| SMILES | C=C(C)CNC(=S)NNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H15N3O2S2/c1-9(2)8-12-11(17)13-14-18(15,16)10-6-4-3-5-7-10/h3-7,14H,1,8H2,2H3,(H2,12,13,17) |
| InChIKey | VMWHJIMZKUTNDP-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|