C10H12FN3O2S2 — CID 2210355
1-[(4-fluorophenyl)sulfonylamino]-3-prop-2-enylthiourea (PubChem CID 2210355) has the molecular formula C10H12FN3O2S2 and a molecular weight of 289.36 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)sulfonylamino]-3-prop-2-enylthiourea.
| Compound Name | 1-[(4-fluorophenyl)sulfonylamino]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 2210355 |
| Molecular Formula | C10H12FN3O2S2 |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 1-[(4-fluorophenyl)sulfonylamino]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NNS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H12FN3O2S2/c1-2-7-12-10(17)13-14-18(15,16)9-5-3-8(11)4-6-9/h2-6,14H,1,7H2,(H2,12,13,17) |
| InChIKey | KPFYZHOEPMCMJS-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|