C11H13FN3S+ — CID 4195076
(4-fluorophenyl)methylidene-(prop-2-enylcarbamothioylamino)azanium (PubChem CID 4195076) has the molecular formula C11H13FN3S+ and a molecular weight of 238.31 g/mol. Its IUPAC name is (4-fluorophenyl)methylidene-(prop-2-enylcarbamothioylamino)azanium.
| Compound Name | (4-fluorophenyl)methylidene-(prop-2-enylcarbamothioylamino)azanium |
|---|---|
| PubChem CID | 4195076 |
| Molecular Formula | C11H13FN3S+ |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (4-fluorophenyl)methylidene-(prop-2-enylcarbamothioylamino)azanium |
| SMILES | C=CCNC(=S)N[NH+]=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C11H12FN3S/c1-2-7-13-11(16)15-14-8-9-3-5-10(12)6-4-9/h2-6,8H,1,7H2,(H2,13,15,16)/p+1 |
| InChIKey | GPFOBHFKYYWAMH-UHFFFAOYSA-O |
| XLogP | -0.11 |
| TPSA | 38.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|