C13H15F2N3O2S — CID 17373407
1-[2-(2,4-difluorophenoxy)propanoylamino]-3-prop-2-enylthiourea (PubChem CID 17373407) has the molecular formula C13H15F2N3O2S and a molecular weight of 315.35 g/mol. Its IUPAC name is 1-[2-(2,4-difluorophenoxy)propanoylamino]-3-prop-2-enylthiourea.
| Compound Name | 1-[2-(2,4-difluorophenoxy)propanoylamino]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 17373407 |
| Molecular Formula | C13H15F2N3O2S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 1-[2-(2,4-difluorophenoxy)propanoylamino]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NNC(=O)C(C)Oc1ccc(F)cc1F |
| InChI | InChI=1S/C13H15F2N3O2S/c1-3-6-16-13(21)18-17-12(19)8(2)20-11-5-4-9(14)7-10(11)15/h3-5,7-8H,1,6H2,2H3,(H,17,19)(H2,16,18,21) |
| InChIKey | HRBNAGPLQWKYGQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|