C13H16ClN3O2S — CID 17371318
1-[2-(3-chlorophenoxy)propanoylamino]-3-prop-2-enylthiourea (PubChem CID 17371318) has the molecular formula C13H16ClN3O2S and a molecular weight of 313.81 g/mol. Its IUPAC name is 1-[2-(3-chlorophenoxy)propanoylamino]-3-prop-2-enylthiourea.
| Compound Name | 1-[2-(3-chlorophenoxy)propanoylamino]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 17371318 |
| Molecular Formula | C13H16ClN3O2S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 1-[2-(3-chlorophenoxy)propanoylamino]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NNC(=O)C(C)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H16ClN3O2S/c1-3-7-15-13(20)17-16-12(18)9(2)19-11-6-4-5-10(14)8-11/h3-6,8-9H,1,7H2,2H3,(H,16,18)(H2,15,17,20) |
| InChIKey | CRBSSCOCGHNEPV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|