C13H14ClNO3 — CID 43324815
2-(4-chloro-2-formylphenoxy)-N-prop-2-enylpropanamide (PubChem CID 43324815) has the molecular formula C13H14ClNO3 and a molecular weight of 267.71 g/mol. Its IUPAC name is 2-(4-chloro-2-formylphenoxy)-N-prop-2-enylpropanamide.
| Compound Name | 2-(4-chloro-2-formylphenoxy)-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 43324815 |
| Molecular Formula | C13H14ClNO3 |
| Molecular Weight | 267.71 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 2-(4-chloro-2-formylphenoxy)-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(C)Oc1ccc(Cl)cc1C=O |
| InChI | InChI=1S/C13H14ClNO3/c1-3-6-15-13(17)9(2)18-12-5-4-11(14)7-10(12)8-16/h3-5,7-9H,1,6H2,2H3,(H,15,17) |
| InChIKey | RREKHEBKKXXJBN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.71 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|