C12H13Cl2NO4S — CID 82921733
5-chloro-2-[1-oxo-1-(prop-2-enylamino)propan-2-yl]oxybenzenesulfonyl chloride (PubChem CID 82921733) has the molecular formula C12H13Cl2NO4S and a molecular weight of 338.21 g/mol. Its IUPAC name is 5-chloro-2-[1-oxo-1-(prop-2-enylamino)propan-2-yl]oxybenzenesulfonyl chloride.
| Compound Name | 5-chloro-2-[1-oxo-1-(prop-2-enylamino)propan-2-yl]oxybenzenesulfonyl chloride |
|---|---|
| PubChem CID | 82921733 |
| Molecular Formula | C12H13Cl2NO4S |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 5-chloro-2-[1-oxo-1-(prop-2-enylamino)propan-2-yl]oxybenzenesulfonyl chloride |
| SMILES | C=CCNC(=O)C(C)Oc1ccc(Cl)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C12H13Cl2NO4S/c1-3-6-15-12(16)8(2)19-10-5-4-9(13)7-11(10)20(14,17)18/h3-5,7-8H,1,6H2,2H3,(H,15,16) |
| InChIKey | GXRLTVGVXYYRKC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|