C12H14Cl2N2O4S — CID 82911197
2-(2,3-dichloro-4-sulfamoylphenoxy)-N-prop-2-enylpropanamide (PubChem CID 82911197) has the molecular formula C12H14Cl2N2O4S and a molecular weight of 353.23 g/mol. Its IUPAC name is 2-(2,3-dichloro-4-sulfamoylphenoxy)-N-prop-2-enylpropanamide.
| Compound Name | 2-(2,3-dichloro-4-sulfamoylphenoxy)-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 82911197 |
| Molecular Formula | C12H14Cl2N2O4S |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 2-(2,3-dichloro-4-sulfamoylphenoxy)-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(C)Oc1ccc(S(N)(=O)=O)c(Cl)c1Cl |
| InChI | InChI=1S/C12H14Cl2N2O4S/c1-3-6-16-12(17)7(2)20-8-4-5-9(21(15,18)19)11(14)10(8)13/h3-5,7H,1,6H2,2H3,(H,16,17)(H2,15,18,19) |
| InChIKey | WAIVGXYBHGHBPI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|