C12H15FN2O4S — CID 82915467
2-(4-fluoro-2-sulfamoylphenoxy)-N-prop-2-enylpropanamide (PubChem CID 82915467) has the molecular formula C12H15FN2O4S and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-(4-fluoro-2-sulfamoylphenoxy)-N-prop-2-enylpropanamide.
| Compound Name | 2-(4-fluoro-2-sulfamoylphenoxy)-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 82915467 |
| Molecular Formula | C12H15FN2O4S |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2-(4-fluoro-2-sulfamoylphenoxy)-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(C)Oc1ccc(F)cc1S(N)(=O)=O |
| InChI | InChI=1S/C12H15FN2O4S/c1-3-6-15-12(16)8(2)19-10-5-4-9(13)7-11(10)20(14,17)18/h3-5,7-8H,1,6H2,2H3,(H,15,16)(H2,14,17,18) |
| InChIKey | GPSIVOZZIAAQDG-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|