C13H13BrFNO3 — CID 18092138
[1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-bromo-4-fluorobenzoate (PubChem CID 18092138) has the molecular formula C13H13BrFNO3 and a molecular weight of 330.15 g/mol. Its IUPAC name is [1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-bromo-4-fluorobenzoate.
| Compound Name | [1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-bromo-4-fluorobenzoate |
|---|---|
| PubChem CID | 18092138 |
| Molecular Formula | C13H13BrFNO3 |
| Molecular Weight | 330.15 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | [1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-bromo-4-fluorobenzoate |
| SMILES | C=CCNC(=O)C(C)OC(=O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C13H13BrFNO3/c1-3-6-16-12(17)8(2)19-13(18)10-5-4-9(15)7-11(10)14/h3-5,7-8H,1,6H2,2H3,(H,16,17) |
| InChIKey | UEYQBFCACSTTIN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.15 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|