C11H11Br2NO3S — CID 8937896
[(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 4,5-dibromothiophene-2-carboxylate (PubChem CID 8937896) has the molecular formula C11H11Br2NO3S and a molecular weight of 397.09 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 4,5-dibromothiophene-2-carboxylate.
| Compound Name | [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 4,5-dibromothiophene-2-carboxylate |
|---|---|
| PubChem CID | 8937896 |
| Molecular Formula | C11H11Br2NO3S |
| Molecular Weight | 397.09 g/mol |
| Exact Mass | 394.88 |
| IUPAC Name | [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 4,5-dibromothiophene-2-carboxylate |
| SMILES | C=CCNC(=O)[C@@H](C)OC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C11H11Br2NO3S/c1-3-4-14-10(15)6(2)17-11(16)8-5-7(12)9(13)18-8/h3,5-6H,1,4H2,2H3,(H,14,15)/t6-/m1/s1 |
| InChIKey | YVQZEHOFDKHONR-ZCFIWIBFSA-N |
| XLogP | 3.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.09 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|