C13H9Br2ClN2O3S — CID 55420320
[1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 4,5-dibromothiophene-2-carboxylate (PubChem CID 55420320) has the molecular formula C13H9Br2ClN2O3S and a molecular weight of 468.55 g/mol. Its IUPAC name is [1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 4,5-dibromothiophene-2-carboxylate.
| Compound Name | [1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 4,5-dibromothiophene-2-carboxylate |
|---|---|
| PubChem CID | 55420320 |
| Molecular Formula | C13H9Br2ClN2O3S |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 465.84 |
| IUPAC Name | [1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 4,5-dibromothiophene-2-carboxylate |
| SMILES | CC(OC(=O)c1cc(Br)c(Br)s1)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C13H9Br2ClN2O3S/c1-6(12(19)18-8-3-2-4-17-11(8)16)21-13(20)9-5-7(14)10(15)22-9/h2-6H,1H3,(H,18,19) |
| InChIKey | MGDDYHBSLVXGNZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|